Unique Ingredient Identifier 0MQ44VUN84 is listed as a ingredient substance
| RN | 193273-66-4 |
| NCIT | C78754 |
| PUBCHEM | 216208 |
| INN ID | 7901 |
| MF | C28H35N5O4 |
| INCHI KEY | KVLLHLWBPNCVNR-SKCUWOTOSA-N |
| SMILES | CN1N=C2CCN(C[C@@]2(CC3=CC=CC=C3)C1=O)C(=O)[C@@H](COCC4=CC=CC=C4)NC(=O)C(C)(C)N |