Unique Ingredient Identifier 6UH91I579U is listed as a ingredient substance
| RN | 606143-52-6 |
| NCIT | C66939 |
| PUBCHEM | 10127622 |
| INN ID | 9078 |
| MF | C17H15BrClFN4O3 |
| INCHI KEY | CYOHGALHFOKKQC-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(F)C(NC3=C(Cl)C=C(Br)C=C3)=C(C=C12)C(=O)NOCCO |