Unique Ingredient Identifier C668Q9I33J is listed as a ingredient substance
| RN | 64211-45-6 |
| NCIT | C61869 |
| RXCUI | 32638 |
| PUBCHEM | 5353853 |
| INN ID | 4729 |
| MF | C18H13Cl4N3O |
| INCHI KEY | QRJJEGAJXVEBNE-HKOYGPOVSA-N |
| SMILES | ClC1=CC=C(CO\N=C(/CN2C=CN=C2)C3=CC=C(Cl)C=C3Cl)C(Cl)=C1 |