EZETIMIBE
Substance profile for UNII EOR26LQQ24, enriched with FDA NDC listings, DailyMed labels, legacy aliases, and open chemistry identifiers.

Substance Identity#
- UNII
- EOR26LQQ24
- Preferred term
- EZETIMIBE
- Registry number
- 163222-33-1
- Ingredient type
- INGREDIENT SUBSTANCE
- Molecular formula
- C24H21F2NO3

Chemical And Database Identifiers#
- InChIKey
- OLNTVTPDXPETLC-XPWALMASSA-N
- SMILES
- O[C@@H](CC[C@@H]1[C@H](N(C1=O)C2=CC=C(F)C=C2)C3=CC=C(O)C=C3)C4=CC=C(F)C=C4
- RxCUI
- 341248
- PubChem
- 150311
- NCIt
- C47529
- INN ID
- 8010
Open Chemistry Sources#
| Source | Identifier | Link |
|---|---|---|
| PubChem Compound | 150311 | https://pubchem.ncbi.nlm.nih.gov/compound/150311 |
| PubChem InChIKey Search | OLNTVTPDXPETLC-XPWALMASSA-N | https://pubchem.ncbi.nlm.nih.gov/#query=OLNTVTPDXPETLC-XPWALMASSA-N |
| RxNorm | 341248 | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=341248 |
| NCI Thesaurus | C47529 | https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI_Thesaurus&code=C47529 |
| FDA Substance Registration System | EOR26LQQ24 | https://precision.fda.gov/uniisearch/srs/unii/EOR26LQQ24 |
Related DailyMed Labels#
| Label | Manufacturer | Effective date |
|---|---|---|
| Ezetimibe | Major Pharmaceuticals | 2026-02-19 |
| EZETIMIBE | Bryant Ranch Prepack | 2026-02-17 |
| Ezetimibe and Simvastatin | A-S Medication Solutions | 2026-02-06 |
| ezetimibe and simvastatin | Organon LLC | 2026-01-21 |
| Bempedoic Acid and Ezetimibe | Esperion Therapeutics, Inc. | Corden Pharma Colorado, Inc. | 2026-01-15 |
| Ezetimibe | AvPAK | 2026-01-13 |
| Ezetimibe | Organon LLC | 2025-11-25 |
| Ezetimibe and Simvastatin | Golden State Medical Supply, Inc. | 2025-11-24 |
| Ezetimibe | Marlex Pharmaceuticals, Inc. | 2025-11-07 |
| EZETIMIBE | Accord Healthcare Inc. | Intas Pharmaceuticals Limited | 2025-10-14 |
| EZETIMIBE | A-S Medication Solutions | 2025-10-14 |
| EZETIMIBE | A-S Medication Solutions | 2025-10-14 |
| Ezetimibe | American Health Packaging | 2025-10-14 |
| Ezetimibe | A-S Medication Solutions | 2025-10-10 |
| Ezetimibe and Simvastatin | Dr.Reddys Laboratories Inc | Dr. Reddy's Laboratories LLC. | 2025-07-18 |
| Ezetimibe | Bryant Ranch Prepack | 2025-07-17 |
| Ezetimibe | Ascend Laboratories, LLC | Alkem Laboratories Limited | 2025-06-13 |
| Ezetimibe | Bryant Ranch Prepack | 2025-05-12 |
| Ezetimibe and Simvastatin | Ascend Laboratories, LLC | Alkem Laboratories Limited | 2025-05-02 |
| Ezetimibe | Aurobindo Pharma Limited | 2025-03-13 |
| Ezetimibe | NorthStar Rx LLC | Aurobindo Pharma Limited | 2025-03-13 |
| Ezetimibe | Proficient Rx LP | 2025-03-01 |
| Ezetimibe | Amneal Pharmaceuticals NY LLC | Amneal Pharmaceuticals Private Limited | 2025-02-10 |
| Ezetimibe and Simvastatin | Amneal Pharmaceuticals NY LLC | Amneal Pharmaceuticals Private Limited | 2025-01-30 |
| ezetimibe | Zydus Lifesciences Limited | 2024-11-28 |
| Ezetimibe and Simvastatin | Aurobindo Pharma Limited | APL HEALTHCARE LIMITED | 2024-10-22 |
| Ezetimibe | A-S Medication Solutions | 2024-10-21 |
| Ezetimibe | A-S Medication Solutions | 2024-10-21 |
| Ezetimibe | A-S Medication Solutions | 2024-09-29 |
| ezetimibe and simvastatin | NORTHSTAR RX LLC | Glenmark Pharmaceuticals Limited | 2024-09-27 |
| Ezetimibe | Glenmark Pharmaceuticals Inc., USA | Glenmark Pharmaceuticals Limited | 2024-07-31 |
| Ezetimibe | RedPharm Drug | 2024-07-25 |
| EZETIMIBE | Camber Pharmaceuticals, Inc. | Hetero Labs Limited Unit III | 2024-07-19 |
| Ezetimibe | Bryant Ranch Prepack | 2024-07-09 |
| Ezetimibe | ScieGen Pharmaceuticals Inc | 2024-06-12 |
| Ezetimibe | Macleods Pharmaceuticals Limited | OXALIS LABS | 2024-05-13 |
| Ezetimibe | A-S Medication Solutions | 2024-05-06 |
| ezetimibe and simvastatin | Glenmark Pharmaceuticals Inc., USA | Glenmark Pharmaceuticals Limited | 2024-04-30 |
| Ezetimibe | Orient Pharma Co., Ltd. | 2024-04-15 |
| Ezetimibe | Bryant Ranch Prepack | 2024-04-04 |
| Ezetimibe | Bryant Ranch Prepack | 2024-04-03 |
| Ezetimibe | Golden State Medical Supply, Inc. | 2024-03-25 |
| ezetimibe | Quallent Pharmaceuticals Health LLC | Zydus Pharmaceuticals USA Inc. | Zydus Lifesciences Limited | 2024-03-20 |
| Ezetimibe | Sandoz Inc | 2024-03-11 |
| Ezetimibe | Ohm Laboratories Inc. | 2024-03-05 |
| Ezetimibe | Actavis Pharma, Inc. | 2024-03-03 |
| ezetimibe | Zydus Pharmaceuticals USA Inc. | Zydus Lifesciences Limited | 2024-02-27 |
| Ezetimibe | A-S Medication Solutions | 2024-02-22 |
| (ezetimibe and atorvastatin) | Althera Pharmaceuticals, LLC | 2024-01-24 |
| ezetimibe and simvastatin | A-S Medication Solutions | 2024-01-16 |
| Ezetimibe | Proficient Rx LP | 2024-01-01 |
| Ezetimibe | A-S Medication Solutions | 2023-09-21 |
| Ezetimibe | A-S Medication Solutions | 2023-08-31 |
| EZETIMIBE | direct rx | 2022-09-29 |
| Ezetimibe | Proficient Rx LP | 2022-08-01 |
| Ezetimibe | Proficient Rx LP | 2019-10-01 |
| Ezetimibe | A-S Medication Solutions | 2019-02-01 |
| Ezetimibe and Simvastatin | A-S Medication Solutions | 2018-12-20 |
| ezetimibe and simvastatin | Physicians Total Care, Inc. | 2012-09-06 |
| Ezetimibe | Rebel Distributors Corp | 2011-01-26 |
| ezetimibe and simvastatin | Rebel Distributors Corp | 2010-12-01 |
| Ezetimibe | Physicians Total Care, Inc. | 2009-12-29 |
Related NDC Products#
| NDC | Name | Nonproprietary name | Labeler | Marketing category |
|---|---|---|---|---|
| 0591-3713 | Ezetimibe | Ezetimibe | Actavis Pharma, Inc. | ANDA |
| 0781-5690 | Ezetimibe | Ezetimibe | Sandoz Inc | ANDA |
| 0904-7103 | Ezetimibe | Ezetimibe | Major Pharmaceuticals | ANDA |
| 10135-787 | Ezetimibe | Ezetimibe | Marlex Pharmaceuticals, Inc. | ANDA |
| 16714-813 | Ezetimibe | Ezetimibe | NorthStar Rx LLC | ANDA |
| 16729-433 | EZETIMIBE | EZETIMIBE | Accord Healthcare Inc. | ANDA |
| 31722-628 | EZETIMIBE | EZETIMIBE | Camber Pharmaceuticals, Inc. | ANDA |
| 33342-373 | Ezetimibe | Ezetimibe | Macleods Pharmaceuticals Limited | ANDA |
| 50090-3422 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-3657 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-6630 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-6631 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-7099 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-7236 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-7338 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-7339 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-7689 | EZETIMIBE | EZETIMIBE | A-S Medication Solutions | ANDA |
| 50090-7690 | EZETIMIBE | EZETIMIBE | A-S Medication Solutions | ANDA |
| 50228-379 | Ezetimibe | Ezetimibe | ScieGen Pharmaceuticals Inc | ANDA |
| 50268-298 | Ezetimibe | Ezetimibe | AvPAK | ANDA |
| 51660-200 | Ezetimibe | Ezetimibe | Ohm Laboratories Inc. | ANDA |
| 59651-052 | Ezetimibe | Ezetimibe | Aurobindo Pharma Limited | ANDA |
| 60429-982 | Ezetimibe | Ezetimibe | Golden State Medical Supply, Inc. | ANDA |
| 60687-373 | Ezetimibe | Ezetimibe | American Health Packaging | ANDA |
| 63629-7413 | Ezetimibe | Ezetimibe | Bryant Ranch Prepack | ANDA |
| 67877-490 | Ezetimibe | Ezetimibe | Ascend Laboratories, LLC | ANDA |
| 68382-773 | ezetimibe | ezetimibe | Zydus Pharmaceuticals USA Inc. | ANDA |
| 68462-226 | Ezetimibe | Ezetimibe | Glenmark Pharmaceuticals Inc., USA | ANDA |
| 69238-1154 | Ezetimibe | Ezetimibe | Amneal Pharmaceuticals NY LLC | ANDA |
| 70771-1109 | ezetimibe | ezetimibe | Zydus Lifesciences Limited | ANDA |
| 71205-145 | Ezetimibe | Ezetimibe | Proficient Rx LP | ANDA |
| 71205-277 | Ezetimibe | Ezetimibe | Proficient Rx LP | ANDA |
| 71335-0684 | Ezetimibe | Ezetimibe | Bryant Ranch Prepack | ANDA |
| 71335-0933 | Ezetimibe | Ezetimibe | Bryant Ranch Prepack | ANDA |
| 71335-1127 | Ezetimibe | Ezetimibe | Bryant Ranch Prepack | ANDA |
| 71335-2123 | Ezetimibe | Ezetimibe | Bryant Ranch Prepack | ANDA |
| 71335-3092 | EZETIMIBE | EZETIMIBE | Bryant Ranch Prepack | ANDA |
| 76333-170 | Ezetimibe | Ezetimibe | Orient Pharma Co., Ltd. | ANDA |
| 78206-178 | Zetia | Ezetimibe | Organon LLC | NDA |
| 82009-024 | ezetimibe | ezetimibe | Quallent Pharmaceuticals Health LLC | ANDA |
| 82804-064 | Ezetimibe | Ezetimibe | Proficient Rx LP | ANDA |
| 82804-211 | Ezetimibe | Ezetimibe | Proficient Rx LP | ANDA |
| 0615-8300 | Ezetimibe | Ezetimibe | NCS HealthCare of KY, Inc dba Vangard Labs | ANDA |
| 0904-6664 | Ezetimibe | Ezetimibe | Major Pharmaceuticals | ANDA |
| 21695-778 | Zetia | Ezetimibe | Rebel Distributors Corp | NDA |
| 42291-314 | Ezetimibe | Ezetimibe | AvKARE, Inc. | ANDA |
| 49884-228 | Ezetimibe | Ezetimibe | Par Pharmaceutical Inc | ANDA |
| 50090-0833 | Zetia | Ezetimibe | A-S Medication Solutions | NDA |
| 50090-2717 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-3087 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 50090-3402 | Ezetimibe | Ezetimibe | A-S Medication Solutions | ANDA |
| 55154-5031 | Zetia | Ezetimibe | Cardinal Health | NDA |
| 55154-5034 | Zetia | Ezetimibe | Cardinal Health | NDA |
| 55154-5043 | Zetia | Ezetimibe | Cardinal Health | NDA |
| 60505-2945 | Ezetimibe | Ezetimibe | Apotex Corp. | ANDA |
| 60687-284 | Ezetimibe | Ezetimibe | American Health Packaging | ANDA |
| 66582-414 | Zetia | Ezetimibe | Merck Sharp & Dohme Corp. | NDA |
| 68788-8297 | Ezetimibe | Ezetimibe | Preferred Pharmaceuticals Inc. | ANDA |
| 70518-1783 | Ezetimibe | Ezetimibe | REMEDYREPACK INC. | ANDA |
| 70518-1927 | Ezetimibe | Ezetimibe | REMEDYREPACK INC. | ANDA |
| 70518-2262 | Ezetimibe | Ezetimibe | REMEDYREPACK INC. | ANDA |
| 70518-3334 | Ezetimibe | Ezetimibe | REMEDYREPACK INC. | ANDA |